CAS 81969-62-2 is the registry number for 3,5,6-Tri-O-benzyl-D-glucofuranose. Offered by: Biosynth. Available pack sizes: 50g, 25g, 100g, 1000g, 250g.
(2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxyoxolane-2,3-diol (CAS 81969-62-2) is a chemical compound with the molecular formula C27H30O6 and a molecular weight of 450.5 g/mol. IUPAC name: (2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxyoxolane-2,3-diol. InChIKey: ZEJKXJXUVQVSEA-ACFIUOAZSA-N.
| Molecular formula | C27H30O6 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | (2S,3R,4R,5R)-5-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-phenylmethoxyoxolane-2,3-diol |
| InChIKey | ZEJKXJXUVQVSEA-ACFIUOAZSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H]([C@@H]2[C@@H]([C@H]([C@H](O2)O)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)