CAS 81972-27-2 appears in our catalog under these names: 3–(1,2,2–Trichlorovinyl)aniline hydrochloride, 3-(1,2,2-Trichlorovinyl)aniline hydrochloride, 95% mix TBC as stabilizer, 95% mix TBC as stabilizer, 3-Trichlorovinylaniline (hydrochloride), 98.58%, 3-(1,2,2-Trichlorovinyl)aniline hydrochloride, 98%+,RG. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 25g, 5g, 1g, 1 g.
3-(1,2,2-trichloroethenyl)aniline;hydrochloride (CAS 81972-27-2) is a chemical compound with the molecular formula C8H7Cl4N and a molecular weight of 259.0 g/mol. IUPAC name: 3-(1,2,2-trichloroethenyl)aniline;hydrochloride. InChIKey: RXKNTFGQXQGYDW-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl4N |
|---|---|
| Molecular weight | 259.0 g/mol |
| IUPAC name | 3-(1,2,2-trichloroethenyl)aniline;hydrochloride |
| InChIKey | RXKNTFGQXQGYDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=C(Cl)Cl)Cl.Cl |
Computed by PubChem (NCBI)