CAS 819793-73-2 is the registry number for 7-Chloro-N-methyl-N-nitroso-5-phenyl-3H-1,4-benzodiazepin-2-amine. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
N-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-N-methylnitrous amide (CAS 819793-73-2) is a chemical compound with the molecular formula C16H13ClN4O and a molecular weight of 312.75 g/mol. IUPAC name: N-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-N-methylnitrous amide. InChIKey: MNHJGWVBNXONPD-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN4O |
|---|---|
| Molecular weight | 312.75 g/mol |
| IUPAC name | N-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)-N-methylnitrous amide |
| InChIKey | MNHJGWVBNXONPD-UHFFFAOYSA-N |
| SMILES | CN(C1=NC2=C(C=C(C=C2)Cl)C(=NC1)C3=CC=CC=C3)N=O |
Computed by PubChem (NCBI)