CAS 81997-89-9 is the registry number for 2-Azido-2-deoxy-D-glucofuranurono-6,3-lactone. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
(2R)-2-azido-2-[(2R,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]acetaldehyde (CAS 81997-89-9) is a chemical compound with the molecular formula C6H7N3O5 and a molecular weight of 201.14 g/mol. IUPAC name: (2R)-2-azido-2-[(2R,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]acetaldehyde. InChIKey: SBUHVPRWVHWICG-SKNVOMKLSA-N.
| Molecular formula | C6H7N3O5 |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | (2R)-2-azido-2-[(2R,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]acetaldehyde |
| InChIKey | SBUHVPRWVHWICG-SKNVOMKLSA-N |
| SMILES | C(=O)[C@@H]([C@@H]1[C@@H]([C@@H](C(=O)O1)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)