CAS 81997-92-4 appears in our catalog under these names: 2-Azido-2-deoxy-D-galacturonate 1,3,4-Triacetate Methyl Ester, 2-Azido-1,3,4-tri-O-acetyl-2-deoxy-D-galacturonide methyl ester. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg, 2mg.
Methyl (2S,3R,4R,5R)-3,4,6-triacetyloxy-5-azidooxane-2-carboxylate (CAS 81997-92-4) is a chemical compound with the molecular formula C13H17N3O9 and a molecular weight of 359.29 g/mol. IUPAC name: methyl (2S,3R,4R,5R)-3,4,6-triacetyloxy-5-azidooxane-2-carboxylate. InChIKey: MPMKPOBPFWONGP-LWYAWAMPSA-N.
| Molecular formula | C13H17N3O9 |
|---|---|
| Molecular weight | 359.29 g/mol |
| IUPAC name | methyl (2S,3R,4R,5R)-3,4,6-triacetyloxy-5-azidooxane-2-carboxylate |
| InChIKey | MPMKPOBPFWONGP-LWYAWAMPSA-N |
| SMILES | CC(=O)O[C@H]1[C@H]([C@H](OC([C@@H]1N=[N+]=[N-])OC(=O)C)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)