CAS 82-21-3 appears in our catalog under these names: 1,5-Diphenoxyanthraquinone, 95%, 1,5-Diphenoxyanthraquinone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg.
1,5-diphenoxyanthracene-9,10-dione (CAS 82-21-3) is a chemical compound with the molecular formula C26H16O4 and a molecular weight of 392.4 g/mol. IUPAC name: 1,5-diphenoxyanthracene-9,10-dione. InChIKey: GSNYYYXHQZHEFP-UHFFFAOYSA-N.
| Molecular formula | C26H16O4 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 1,5-diphenoxyanthracene-9,10-dione |
| InChIKey | GSNYYYXHQZHEFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)OC5=CC=CC=C5 |
Computed by PubChem (NCBI)