CAS 82-62-2 appears in our catalog under these names: 3,4,6-Trichloro-2-nitrophenol, 95%, 6-Iodo-2,4,5-trichlorophenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
3,4,6-trichloro-2-nitrophenol (CAS 82-62-2) is a chemical compound with the molecular formula C6H2Cl3NO3 and a molecular weight of 242.4 g/mol. IUPAC name: 3,4,6-trichloro-2-nitrophenol. InChIKey: XWLBYVXDCGYXGY-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO3 |
|---|---|
| Molecular weight | 242.4 g/mol |
| IUPAC name | 3,4,6-trichloro-2-nitrophenol |
| InChIKey | XWLBYVXDCGYXGY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)[N+](=O)[O-])O)Cl |
Computed by PubChem (NCBI)