CAS 82050-12-2 appears in our catalog under these names: Hydroxy Flubendazole, Flubendazole Impurity 1(Flubendazole alcohol), Flubendazole alcohol, >95% (HPLC), Flubendazole-hydroxy, Flubendazole-hydroxy 100 µg/mL in Acetonitrile. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 1ml.
Methyl N-[6-[(4-fluorophenyl)-hydroxymethyl]-1H-benzimidazol-2-yl]carbamate (CAS 82050-12-2) is a chemical compound with the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. IUPAC name: methyl N-[6-[(4-fluorophenyl)-hydroxymethyl]-1H-benzimidazol-2-yl]carbamate. InChIKey: GONRXGWUUBPRKF-UHFFFAOYSA-N.
| Molecular formula | C16H14FN3O3 |
|---|---|
| Molecular weight | 315.30 g/mol |
| IUPAC name | methyl N-[6-[(4-fluorophenyl)-hydroxymethyl]-1H-benzimidazol-2-yl]carbamate |
| InChIKey | GONRXGWUUBPRKF-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(C3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)