CAS 82051-88-5 is the registry number for 2,4,6-tribromo-3,5-dimethylaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,6-tribromo-3,5-dimethylaniline (CAS 82051-88-5) is a chemical compound with the molecular formula C8H8Br3N and a molecular weight of 357.87 g/mol. IUPAC name: 2,4,6-tribromo-3,5-dimethylaniline. InChIKey: NIFOLKXNFGFBCX-UHFFFAOYSA-N.
| Molecular formula | C8H8Br3N |
|---|---|
| Molecular weight | 357.87 g/mol |
| IUPAC name | 2,4,6-tribromo-3,5-dimethylaniline |
| InChIKey | NIFOLKXNFGFBCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)N)Br)C)Br |
Computed by PubChem (NCBI)