CAS 82058-16-0 appears in our catalog under these names: NSC-33994, NSC 33994, NSC 33994. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 10mg, 50mg, 100mg, Get quote.
2-(diethylaminomethyl)-4-[(E)-4-[3-(diethylaminomethyl)-4-hydroxyphenyl]hex-3-en-3-yl]phenol (CAS 82058-16-0) is a chemical compound with the molecular formula C28H42N2O2 and a molecular weight of 438.6 g/mol. IUPAC name: 2-(diethylaminomethyl)-4-[(E)-4-[3-(diethylaminomethyl)-4-hydroxyphenyl]hex-3-en-3-yl]phenol. InChIKey: QFNJFVBKASKGEU-OCEACIFDSA-N.
| Molecular formula | C28H42N2O2 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | 2-(diethylaminomethyl)-4-[(E)-4-[3-(diethylaminomethyl)-4-hydroxyphenyl]hex-3-en-3-yl]phenol |
| InChIKey | QFNJFVBKASKGEU-OCEACIFDSA-N |
| SMILES | CC/C(=C(/CC)\C1=CC(=C(C=C1)O)CN(CC)CC)/C2=CC(=C(C=C2)O)CN(CC)CC |
Computed by PubChem (NCBI)