CAS 82083-43-0 appears in our catalog under these names: (+)–Muscarine (tosylate), (+)-Muscarine tosylate, Muscarine (tosylate). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 10mg, 50mg, 250mg, 100mg, Get quote.
[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;4-methylbenzenesulfonate (CAS 82083-43-0) is a chemical compound with the molecular formula C16H27NO5S and a molecular weight of 345.5 g/mol. IUPAC name: [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;4-methylbenzenesulfonate. InChIKey: WSPIVBJGIYPMNQ-CTERPIQNSA-M.
| Molecular formula | C16H27NO5S |
|---|---|
| Molecular weight | 345.5 g/mol |
| IUPAC name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium;4-methylbenzenesulfonate |
| InChIKey | WSPIVBJGIYPMNQ-CTERPIQNSA-M |
| SMILES | C[C@H]1[C@@H](C[C@H](O1)C[N+](C)(C)C)O.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)