CAS 82117-26-8 is the registry number for 3-Chloro-7-fluoroisoquinoline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
3-chloro-7-fluoroisoquinoline (CAS 82117-26-8) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 3-chloro-7-fluoroisoquinoline. InChIKey: YGDRWTHVHZAKTA-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 3-chloro-7-fluoroisoquinoline |
| InChIKey | YGDRWTHVHZAKTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CN=C(C=C21)Cl)F |
Computed by PubChem (NCBI)