Products 82147-31-7

CAS 82147-31-7 is the registry number for WR 151327. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

3-[3-(methylamino)propylamino]propylsulfanylphosphonic acid (CAS 82147-31-7) is a chemical compound with the molecular formula C7H19N2O3PS and a molecular weight of 242.28 g/mol. IUPAC name: 3-[3-(methylamino)propylamino]propylsulfanylphosphonic acid. InChIKey: RJCFTKZFLQWQQX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H19N2O3PS
Molecular weight242.28 g/mol
IUPAC name3-[3-(methylamino)propylamino]propylsulfanylphosphonic acid
InChIKeyRJCFTKZFLQWQQX-UHFFFAOYSA-N
SMILESCNCCCNCCCSP(=O)(O)O

Computed by PubChem (NCBI)