CAS 821768-06-3 appears in our catalog under these names: JNJ 17203212, JNJ-17203212/ 99.94% (existing batch purity), JNJ 17203212, JNJ-17203212, JNJ-17203212 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg.
4-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide (CAS 821768-06-3) is a chemical compound with the molecular formula C17H15F6N5O and a molecular weight of 419.32 g/mol. IUPAC name: 4-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide. InChIKey: JFRYYGVYCWYIDQ-UHFFFAOYSA-N.
| Molecular formula | C17H15F6N5O |
|---|---|
| Molecular weight | 419.32 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)-2-pyridinyl]-N-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxamide |
| InChIKey | JFRYYGVYCWYIDQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=C(C=CC=N2)C(F)(F)F)C(=O)NC3=NC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)