CAS 82190-91-8 is the registry number for Flufylline. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, Get quote.
7-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione (CAS 82190-91-8) is a chemical compound with the molecular formula C21H24FN5O3 and a molecular weight of 413.4 g/mol. IUPAC name: 7-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione. InChIKey: PMEYQPKJAPXGPS-UHFFFAOYSA-N.
| Molecular formula | C21H24FN5O3 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 7-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-1,3-dimethylpurine-2,6-dione |
| InChIKey | PMEYQPKJAPXGPS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCN3CCC(CC3)C(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)