CAS 822-18-4 appears in our catalog under these names: α–Linolenic Acid (sodium salt), Sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate, α-Linolenic acid (sodium), 96.67%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 250mg, 1g, 10 mg, 50 mg, 25 mg.
Sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (CAS 822-18-4) is a chemical compound with the molecular formula C18H29NaO2 and a molecular weight of 300.4 g/mol. IUPAC name: sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate. InChIKey: UNZSHUCNBUBSGW-IFNWOZJISA-M.
| Molecular formula | C18H29NaO2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| InChIKey | UNZSHUCNBUBSGW-IFNWOZJISA-M |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)