CAS 82202-41-3 is the registry number for 2,2,2-Trichloro-N-(pyridin-3-yl)acetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
2,2,2-trichloro-N-pyridin-3-ylacetamide (CAS 82202-41-3) is a chemical compound with the molecular formula C7H5Cl3N2O and a molecular weight of 239.5 g/mol. IUPAC name: 2,2,2-trichloro-N-pyridin-3-ylacetamide. InChIKey: IAJBRNJSFKORJC-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3N2O |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2,2,2-trichloro-N-pyridin-3-ylacetamide |
| InChIKey | IAJBRNJSFKORJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NC(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)