CAS 82205-98-9 is the registry number for Hydrochlorothiazide Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 82205-98-9) is a chemical compound with the molecular formula C7H9N3O5S2 and a molecular weight of 279.3 g/mol. IUPAC name: 6-hydroxy-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: QLCTWQHNZORGOV-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O5S2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 6-hydroxy-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | QLCTWQHNZORGOV-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)O |
Computed by PubChem (NCBI)