CAS 82223-91-4 appears in our catalog under these names: (1E,3E)-2-Methyl-1-(trimethylsilyloxy)-1,3-pentadiene, 95%, Trimethyl(((1E,3E)-2-methylpenta-1,3-dien-1-yl)oxy)silane, 95% GC, Trimethyl(((1E，3E)–2–methylpenta–1，3–dien–1–yl)oxy)silane, Trimethyl[[(1E,3E)-2-methylpenta-1,3-dien-1-yl]oxy]silane, >95.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 5g, 1g, 250mg, 1ml, 5ml.
Trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane (CAS 82223-91-4) is a chemical compound with the molecular formula C9H18OSi and a molecular weight of 170.32 g/mol. IUPAC name: trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane. InChIKey: KCWJPELNBSKTNR-BLHCBFLLSA-N.
| Molecular formula | C9H18OSi |
|---|---|
| Molecular weight | 170.32 g/mol |
| IUPAC name | trimethyl-[(1E,3E)-2-methylpenta-1,3-dienoxy]silane |
| InChIKey | KCWJPELNBSKTNR-BLHCBFLLSA-N |
| SMILES | C/C=C/C(=C/O[Si](C)(C)C)/C |
Computed by PubChem (NCBI)