CAS 82225-32-9 appears in our catalog under these names: Propargyl 4-bromobenzamide, 98%, 4-Bromo-N-(prop-2-yn-1-yl)benzamide 98%, Propargyl 4-bromobenzamide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-bromo-N-prop-2-ynylbenzamide (CAS 82225-32-9) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 4-bromo-N-prop-2-ynylbenzamide. InChIKey: PIBNSCVOQQZLNJ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-bromo-N-prop-2-ynylbenzamide |
| InChIKey | PIBNSCVOQQZLNJ-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)