CAS 82244-58-4 is the registry number for 4–(Methylthiol–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 20mg.
1-bromo-4-(trideuteriomethylsulfanyl)benzene (CAS 82244-58-4) is a chemical compound with the molecular formula C7H7BrS and a molecular weight of 206.12 g/mol. IUPAC name: 1-bromo-4-(trideuteriomethylsulfanyl)benzene. InChIKey: YEUYZNNBXLMFCW-FIBGUPNXSA-N.
| Molecular formula | C7H7BrS |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 1-bromo-4-(trideuteriomethylsulfanyl)benzene |
| InChIKey | YEUYZNNBXLMFCW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])SC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)