CAS 82259-50-5 is the registry number for D-allose-6-phosphate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Hydroxy-oxo-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphanium (CAS 82259-50-5) is a chemical compound with the molecular formula C6H12O8P+ and a molecular weight of 243.13 g/mol. IUPAC name: hydroxy-oxo-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphanium. InChIKey: RHCXLYOURNFJRR-BGPJRJDNSA-O.
| Molecular formula | C6H12O8P+ |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | hydroxy-oxo-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]phosphanium |
| InChIKey | RHCXLYOURNFJRR-BGPJRJDNSA-O |
| SMILES | C([C@H]([C@H]([C@H]([C@H](C=O)O)O)O)O)O[P+](=O)O |
Computed by PubChem (NCBI)