CAS 82302-97-4 is the registry number for Dimethyl (3,3-difluoro-2-oxo-3-phenylpropyl)phosphonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-dimethoxyphosphoryl-1,1-difluoro-1-phenylpropan-2-one (CAS 82302-97-4) is a chemical compound with the molecular formula C11H13F2O4P and a molecular weight of 278.19 g/mol. IUPAC name: 3-dimethoxyphosphoryl-1,1-difluoro-1-phenylpropan-2-one. InChIKey: BXDMUNJIZCRANF-UHFFFAOYSA-N.
| Molecular formula | C11H13F2O4P |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | 3-dimethoxyphosphoryl-1,1-difluoro-1-phenylpropan-2-one |
| InChIKey | BXDMUNJIZCRANF-UHFFFAOYSA-N |
| SMILES | COP(=O)(CC(=O)C(C1=CC=CC=C1)(F)F)OC |
Computed by PubChem (NCBI)