Products 823221-96-1
CAS 823221-96-1 is the registry number for 3-Chloro-2-iodo-6-(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-chloro-2-iodo-6-(trifluoromethyl)pyridine (CAS 823221-96-1) is a chemical compound with the molecular formula C6H2ClF3IN and a molecular weight of 307.44 g/mol. IUPAC name: 3-chloro-2-iodo-6-(trifluoromethyl)pyridine. InChIKey: VGIFNWJCIIMDPO-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3IN |
|---|---|
| Molecular weight | 307.44 g/mol |
| IUPAC name | 3-chloro-2-iodo-6-(trifluoromethyl)pyridine |
| InChIKey | VGIFNWJCIIMDPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)I)C(F)(F)F |
Computed by PubChem (NCBI)