CAS 82330-99-2 is the registry number for (±)-Oblongine Iodide. Offered by: TRC. Available pack sizes: 100mg.
1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol iodide (CAS 82330-99-2) is a chemical compound with the molecular formula C19H24INO3 and a molecular weight of 441.3 g/mol. IUPAC name: 1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol iodide. InChIKey: GZTTVWHIJPNLJI-UHFFFAOYSA-N.
| Molecular formula | C19H24INO3 |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | 1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol iodide |
| InChIKey | GZTTVWHIJPNLJI-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCC2=C(C1CC3=CC=C(C=C3)O)C(=C(C=C2)OC)O)C.[I-] |
Computed by PubChem (NCBI)