CAS 82337-14-2 is the registry number for SQ 26655. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-7-[(1S,2R,3R,4R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (CAS 82337-14-2) is a chemical compound with the molecular formula C21H34O4 and a molecular weight of 350.5 g/mol. IUPAC name: (Z)-7-[(1S,2R,3R,4R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid. InChIKey: IWSCITFBDCQRGG-BWDSMMMSSA-N.
| Molecular formula | C21H34O4 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | (Z)-7-[(1S,2R,3R,4R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| InChIKey | IWSCITFBDCQRGG-BWDSMMMSSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H]2CC[C@@H]([C@@H]1C/C=C\CCCC(=O)O)O2)O |
Computed by PubChem (NCBI)