Products 82358-61-0

CAS 82358-61-0 appears in our catalog under these names: Cyanomethyltri-n-butylphosphonium chloride, 96%, Tributyl(cyanomethyl)phosphonium Chloride, Tributyl(cyanomethyl)phosphonium Chloride, >98.0%(T), Tributyl(cyanomethyl)phosphonium chloride 98%, Tributyl(cyanomethyl)phosphonium Chloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Tributyl(cyanomethyl)phosphanium chloride (CAS 82358-61-0) is a chemical compound with the molecular formula C14H29ClNP and a molecular weight of 277.81 g/mol. IUPAC name: tributyl(cyanomethyl)phosphanium chloride. InChIKey: JCHWNYYARSRCKZ-UHFFFAOYSA-M.

Identity
Molecular formulaC14H29ClNP
Molecular weight277.81 g/mol
IUPAC nametributyl(cyanomethyl)phosphanium chloride
InChIKeyJCHWNYYARSRCKZ-UHFFFAOYSA-M
SMILESCCCC[P+](CCCC)(CCCC)CC#N.[Cl-]

Computed by PubChem (NCBI)