CAS 82358-61-0 appears in our catalog under these names: Cyanomethyltri-n-butylphosphonium chloride, 96%, Tributyl(cyanomethyl)phosphonium Chloride, Tributyl(cyanomethyl)phosphonium Chloride, >98.0%(T), Tributyl(cyanomethyl)phosphonium chloride 98%, Tributyl(cyanomethyl)phosphonium Chloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
Tributyl(cyanomethyl)phosphanium chloride (CAS 82358-61-0) is a chemical compound with the molecular formula C14H29ClNP and a molecular weight of 277.81 g/mol. IUPAC name: tributyl(cyanomethyl)phosphanium chloride. InChIKey: JCHWNYYARSRCKZ-UHFFFAOYSA-M.
| Molecular formula | C14H29ClNP |
|---|---|
| Molecular weight | 277.81 g/mol |
| IUPAC name | tributyl(cyanomethyl)phosphanium chloride |
| InChIKey | JCHWNYYARSRCKZ-UHFFFAOYSA-M |
| SMILES | CCCC[P+](CCCC)(CCCC)CC#N.[Cl-] |
Computed by PubChem (NCBI)