CAS 823817-55-6 appears in our catalog under these names: Sitagliptin EP Impurity A, Sitagliptin Impurity 7, Sitagliptin EP Impurity A, 95%, 95%, Sitagliptin impurity 20. Offered by: Chemat Brand, Hubei YoungXin, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
(3S)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (CAS 823817-55-6) is a chemical compound with the molecular formula C16H15F6N5O and a molecular weight of 407.31 g/mol. IUPAC name: (3S)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one. InChIKey: MFFMDFFZMYYVKS-VIFPVBQESA-N.
| Molecular formula | C16H15F6N5O |
|---|---|
| Molecular weight | 407.31 g/mol |
| IUPAC name | (3S)-3-amino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| InChIKey | MFFMDFFZMYYVKS-VIFPVBQESA-N |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)C[C@H](CC3=CC(=C(C=C3F)F)F)N |
Computed by PubChem (NCBI)