CAS 82385-42-0 appears in our catalog under these names: Saccharin sodium hydrate, Saccharin sodium hydrate, o-Benzoic sulfimide sodium salt hydrate, 99% , Saccharin sodium salt, Saccharin, sodium salt hydrate, 99+%. Offered by: GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 500mg, 1000g, 5000g, 250g, 2kg, 1kg, 5KG, 10kg.
Sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one;hydrate (CAS 82385-42-0) is a chemical compound with the molecular formula C7H6NNaO4S and a molecular weight of 223.18 g/mol. IUPAC name: sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one;hydrate. InChIKey: ILJOYZVVZZFIKA-UHFFFAOYSA-M.
| Molecular formula | C7H6NNaO4S |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one;hydrate |
| InChIKey | ILJOYZVVZZFIKA-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)[N-]S2(=O)=O.O.[Na+] |
Computed by PubChem (NCBI)