CAS 824-38-4 is the registry number for 2-Nitrophenol Potassium Salt. Offered by: TRC. Available pack sizes: 500mg, 50mg.
Potassium 2-nitrophenolate (CAS 824-38-4) is a chemical compound with the molecular formula C6H4KNO3 and a molecular weight of 177.20 g/mol. IUPAC name: potassium 2-nitrophenolate. InChIKey: VMZBTPALYWVSGZ-UHFFFAOYSA-M.
| Molecular formula | C6H4KNO3 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | potassium 2-nitrophenolate |
| InChIKey | VMZBTPALYWVSGZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])[O-].[K+] |
Computed by PubChem (NCBI)