CAS 824-39-5 appears in our catalog under these names: 2-Nitrophenol sodium salt, 98%, Sodium 2-Nitrophenolate, >95% (HPLC), 2–Nitrophenol sodium salt, 2-Nitrophenol Sodium Salt, >99.0%(HPLC), 2-Nitrophenol Sodium Salt. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 2,5g, 250mg, 500mg.
Sodium 2-nitrophenolate (CAS 824-39-5) is a chemical compound with the molecular formula C6H4NNaO3 and a molecular weight of 161.09 g/mol. IUPAC name: sodium 2-nitrophenolate. InChIKey: AXKBOWBNOCUNJL-UHFFFAOYSA-M.
| Molecular formula | C6H4NNaO3 |
|---|---|
| Molecular weight | 161.09 g/mol |
| IUPAC name | sodium 2-nitrophenolate |
| InChIKey | AXKBOWBNOCUNJL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])[O-].[Na+] |
Computed by PubChem (NCBI)