CAS 82401-08-9 is the registry number for 3-Chloromethyl-pyridine 1-oxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(chloromethyl)-1-oxidopyridin-1-ium (CAS 82401-08-9) is a chemical compound with the molecular formula C6H6ClNO and a molecular weight of 143.57 g/mol. IUPAC name: 3-(chloromethyl)-1-oxidopyridin-1-ium. InChIKey: UCJYEZKDLOGBOD-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO |
|---|---|
| Molecular weight | 143.57 g/mol |
| IUPAC name | 3-(chloromethyl)-1-oxidopyridin-1-ium |
| InChIKey | UCJYEZKDLOGBOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])CCl |
Computed by PubChem (NCBI)