CAS 82460-15-9 is the registry number for 4–(Ethoxy–d5)aniline. Offered by: GLPBio. Available pack sizes: 25mg.
4-(1,1,2,2,2-pentadeuterioethoxy)aniline (CAS 82460-15-9) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 142.21 g/mol. IUPAC name: 4-(1,1,2,2,2-pentadeuterioethoxy)aniline. InChIKey: IMPPGHMHELILKG-ZBJDZAJPSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 142.21 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentadeuterioethoxy)aniline |
| InChIKey | IMPPGHMHELILKG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)