CAS 82474-94-0 is the registry number for Chlorobis(triphenylphosphine)silve, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Chlorosilver;bis(triphenylphosphanium) (CAS 82474-94-0) is a chemical compound with the molecular formula C36H32AgClP2+2 and a molecular weight of 669.9 g/mol. IUPAC name: chlorosilver;bis(triphenylphosphanium). InChIKey: AVNLKIIWDFFLDC-UHFFFAOYSA-O.
| Molecular formula | C36H32AgClP2+2 |
|---|---|
| Molecular weight | 669.9 g/mol |
| IUPAC name | chlorosilver;bis(triphenylphosphanium) |
| InChIKey | AVNLKIIWDFFLDC-UHFFFAOYSA-O |
| SMILES | C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)[PH+](C2=CC=CC=C2)C3=CC=CC=C3.Cl[Ag] |
Computed by PubChem (NCBI)