CAS 824938-99-0 is the registry number for (1S,2S)-2-Morpholinocyclohexanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-2-morpholin-4-ylcyclohexan-1-amine (CAS 824938-99-0) is a chemical compound with the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. IUPAC name: trans-(1S,2S)-2-morpholin-4-ylcyclohexan-1-amine. InChIKey: ZRAFIVNWDABKOL-UWVGGRQHSA-N.
| Molecular formula | C10H20N2O |
|---|---|
| Molecular weight | 184.28 g/mol |
| IUPAC name | trans-(1S,2S)-2-morpholin-4-ylcyclohexan-1-amine |
| InChIKey | ZRAFIVNWDABKOL-UWVGGRQHSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)N2CCOCC2 |
Computed by PubChem (NCBI)