Products 824958-12-5
CAS 824958-12-5 appears in our catalog under these names: LP 44, LP 44 Hydrochloride, LP44 hydrochloride/ 98.06% (existing batch purity), LP 44, LP44 (hydrochloride), 98.12%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 500mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg.
6-[4-(2-methylsulfanylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide;hydrochloride (CAS 824958-12-5) is a chemical compound with the molecular formula C27H38ClN3OS and a molecular weight of 488.1 g/mol. IUPAC name: 6-[4-(2-methylsulfanylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide;hydrochloride. InChIKey: DWGKCWWWKHCVDH-UHFFFAOYSA-N.
| Molecular formula | C27H38ClN3OS |
|---|---|
| Molecular weight | 488.1 g/mol |
| IUPAC name | 6-[4-(2-methylsulfanylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide;hydrochloride |
| InChIKey | DWGKCWWWKHCVDH-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC=C1N2CCN(CC2)CCCCCC(=O)NC3CCCC4=CC=CC=C34.Cl |
Computed by PubChem (NCBI)