CAS 824981-55-7 appears in our catalog under these names: SF-22, 98%, SF-22/ 99.09% (existing batch purity), SF–22, SF-22, SF-22 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 500mg, 250mg.
3-[(2,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-phenylphenyl)benzamide (CAS 824981-55-7) is a chemical compound with the molecular formula C28H26N2O3S and a molecular weight of 470.6 g/mol. IUPAC name: 3-[(2,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-phenylphenyl)benzamide. InChIKey: BWWPVIRXNOWQSI-UHFFFAOYSA-N.
| Molecular formula | C28H26N2O3S |
|---|---|
| Molecular weight | 470.6 g/mol |
| IUPAC name | 3-[(2,5-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-phenylphenyl)benzamide |
| InChIKey | BWWPVIRXNOWQSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NS(=O)(=O)C2=C(C=CC(=C2)C(=O)NC3=CC=CC=C3C4=CC=CC=C4)C |
Computed by PubChem (NCBI)