CAS 824983-83-7 is the registry number for 3-Hydroxy-7-phenyl-1H-thieno(3,2-delta)pyrimidine-2,4-dione. Offered by: TRC. Available pack sizes: 50mg.
3-hydroxy-7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 824983-83-7) is a chemical compound with the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. IUPAC name: 3-hydroxy-7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: ZFJVGRVFNSWCRQ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3S |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 3-hydroxy-7-phenyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | ZFJVGRVFNSWCRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2NC(=O)N(C3=O)O |
Computed by PubChem (NCBI)