CAS 825-41-2 appears in our catalog under these names: 3–Chloro–4–nitroaniline, 3-Chloro-4-nitroaniline, 95% , 3-Chloro-4-nitroaniline, >96.0%(GC), 3-Chloro-4-nitroaniline 97%, 3-Chloro-4-nitroaniline, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 10g, 5g.
3-chloro-4-nitroaniline (CAS 825-41-2) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 3-chloro-4-nitroaniline. InChIKey: LDSIOPGMLLPSSR-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 3-chloro-4-nitroaniline |
| InChIKey | LDSIOPGMLLPSSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)