Products 82514-58-7

CAS 82514-58-7 is the registry number for 2-Amino-5,6-dihydro-4h-cyclopentathiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine;hydrochloride (CAS 82514-58-7) is a chemical compound with the molecular formula C6H9ClN2S and a molecular weight of 176.67 g/mol. IUPAC name: 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine;hydrochloride. InChIKey: XKEVCDYDIQVBRN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2S
Molecular weight176.67 g/mol
IUPAC name5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine;hydrochloride
InChIKeyXKEVCDYDIQVBRN-UHFFFAOYSA-N
SMILESC1CC2=C(C1)SC(=N2)N.Cl

Computed by PubChem (NCBI)