Products 82514-68-9

CAS 82514-68-9 is the registry number for [(4-Methyl-1,3-thiazol-2-yl)amino](oxo)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetic acid (CAS 82514-68-9) is a chemical compound with the molecular formula C6H6N2O3S and a molecular weight of 186.19 g/mol. IUPAC name: 2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetic acid. InChIKey: MBBULHVAUUGXHF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O3S
Molecular weight186.19 g/mol
IUPAC name2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoacetic acid
InChIKeyMBBULHVAUUGXHF-UHFFFAOYSA-N
SMILESCC1=CSC(=N1)NC(=O)C(=O)O

Computed by PubChem (NCBI)