CAS 82518-61-4 appears in our catalog under these names: Boc-orn(dnp)-oh, 95%, Boc-Orn(Dnp)-OH, 98+%, Boc–Orn(Dnp)–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2S)-5-(2,4-dinitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 82518-61-4) is a chemical compound with the molecular formula C16H22N4O8 and a molecular weight of 398.37 g/mol. IUPAC name: (2S)-5-(2,4-dinitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: PXVAXTMGYWSFHF-LBPRGKRZSA-N.
| Molecular formula | C16H22N4O8 |
|---|---|
| Molecular weight | 398.37 g/mol |
| IUPAC name | (2S)-5-(2,4-dinitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | PXVAXTMGYWSFHF-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)