Products 82578-45-8
CAS 82578-45-8 appears in our catalog under these names: (S)-3-Hydroxy-butyric acid tert-butyl ester, 95%, (S)-tert-Butyl 3-hydroxybutanoate, 97%, 97%, (S)-3-Hydroxybutyric acid tert-butyl ester, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
Tert-butyl (3S)-3-hydroxybutanoate (CAS 82578-45-8) is a chemical compound with the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. IUPAC name: tert-butyl (3S)-3-hydroxybutanoate. InChIKey: PKPVFILAHLKSNJ-LURJTMIESA-N.
| Molecular formula | C8H16O3 |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | tert-butyl (3S)-3-hydroxybutanoate |
| InChIKey | PKPVFILAHLKSNJ-LURJTMIESA-N |
| SMILES | C[C@@H](CC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Butanoic acid, 3-hydroxy-, 1,1-dimethylethyl ester, (3S)-, (S)-(+)-Tert-butyl 3-hydroxybutyrate, (S)-tert-butyl 3-hydroxybutanoate, (S)-3-Hydroxy-butyric acid tert-butyl ester, tert-butyl (3S)-3-hydroxybutanoate, Tert-butyl (S)-3-hydroxybutanoate, (S)-3-Hydroxybutyric acid tert-butyl ester, (s)-t-butyl-3-hydroxybutanoate, (+)-tert-Butyl (S)-3-hydroxybutyrate, (S)-tert-Butyl3-hydroxybutanoate