Products 82585-91-9
CAS 82585-91-9 is the registry number for NSC 330770. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl N-(5-amino-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate (CAS 82585-91-9) is a chemical compound with the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. IUPAC name: ethyl N-(5-amino-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate. InChIKey: RLHKYVHZNZMLRH-UHFFFAOYSA-N.
| Molecular formula | C16H17N5O2 |
|---|---|
| Molecular weight | 311.34 g/mol |
| IUPAC name | ethyl N-(5-amino-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate |
| InChIKey | RLHKYVHZNZMLRH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NC(=C2C(=C1)NCC(=N2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)