CAS 82633-69-0 is the registry number for 3-Heptafluoropropyl-5-methyl-4-nitropyrazole, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-4-nitro-1H-pyrazole (CAS 82633-69-0) is a chemical compound with the molecular formula C7H4F7N3O2 and a molecular weight of 295.11 g/mol. IUPAC name: 3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-4-nitro-1H-pyrazole. InChIKey: UOFISFKBSXJEHZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F7N3O2 |
|---|---|
| Molecular weight | 295.11 g/mol |
| IUPAC name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methyl-4-nitro-1H-pyrazole |
| InChIKey | UOFISFKBSXJEHZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C(C(C(F)(F)F)(F)F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)