CAS 82670-07-3 appears in our catalog under these names: 4-Bromo-2-methylnaphthalen-1-amine hydrochloride, 98%, 98%, 4-Bromo-2-methylnaphthalen-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
4-bromo-2-methylnaphthalen-1-amine;hydrochloride (CAS 82670-07-3) is a chemical compound with the molecular formula C11H11BrClN and a molecular weight of 272.57 g/mol. IUPAC name: 4-bromo-2-methylnaphthalen-1-amine;hydrochloride. InChIKey: REJADVPIFNJYHY-UHFFFAOYSA-N.
| Molecular formula | C11H11BrClN |
|---|---|
| Molecular weight | 272.57 g/mol |
| IUPAC name | 4-bromo-2-methylnaphthalen-1-amine;hydrochloride |
| InChIKey | REJADVPIFNJYHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C(=C1)Br)N.Cl |
Computed by PubChem (NCBI)