CAS 82677-84-7 is the registry number for 1-(4-Fluorophenyl)-3-phenylprop-2-yn-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(4-fluorophenyl)-3-phenylprop-2-yn-1-one (CAS 82677-84-7) is a chemical compound with the molecular formula C15H9FO and a molecular weight of 224.23 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-phenylprop-2-yn-1-one. InChIKey: KGXLYUSMGFJWNJ-UHFFFAOYSA-N.
| Molecular formula | C15H9FO |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-phenylprop-2-yn-1-one |
| InChIKey | KGXLYUSMGFJWNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)