CAS 82692-88-4 appears in our catalog under these names: N-(2-Hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium salt, 95%, HDAOS/ 98.66% (existing batch purity), HDAOS, N-(2-Hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline Sodium Salt [for Biochemical Research], >98.0%(HPLC), N-(2-Hydroxy-3-sulfopropyl)-3,5-dimethoxyaniline sodium. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 10mM (in 1ml dmso), 500mg, 200mg, 2g.
Sodium 3-(3,5-dimethoxyanilino)-2-hydroxypropane-1-sulfonate (CAS 82692-88-4) is a chemical compound with the molecular formula C11H16NNaO6S and a molecular weight of 313.30 g/mol. IUPAC name: sodium 3-(3,5-dimethoxyanilino)-2-hydroxypropane-1-sulfonate. InChIKey: SVLRFMQGKVFRTB-UHFFFAOYSA-M.
| Molecular formula | C11H16NNaO6S |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | sodium 3-(3,5-dimethoxyanilino)-2-hydroxypropane-1-sulfonate |
| InChIKey | SVLRFMQGKVFRTB-UHFFFAOYSA-M |
| SMILES | COC1=CC(=CC(=C1)NCC(CS(=O)(=O)[O-])O)OC.[Na+] |
Computed by PubChem (NCBI)