CAS 827-41-8 appears in our catalog under these names: 3-Phenyl-1H-pyrazol-5-amine 97%, 3-Phenyl-1H-pyrazol-5-amine, 97+%, 97+%, 3-Phenyl-1H-pyrazol-5-amine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 25g, 100g, 1g.
5-phenyl-1H-pyrazol-3-amine (CAS 827-41-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 5-phenyl-1H-pyrazol-3-amine. InChIKey: PWSZRRFDVPMZGM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 5-phenyl-1H-pyrazol-3-amine |
| InChIKey | PWSZRRFDVPMZGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2)N |
Computed by PubChem (NCBI)