Products 827026-44-8
CAS 827026-44-8 appears in our catalog under these names: Lenalidomide Impurity 49, 2-(1,3-Dihydro-4-nitro-1-oxo-2H-isoindol-2-yl)pentanediamide. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
2-(7-nitro-3-oxo-1H-isoindol-2-yl)pentanediamide (CAS 827026-44-8) is a chemical compound with the molecular formula C13H14N4O5 and a molecular weight of 306.27 g/mol. IUPAC name: 2-(7-nitro-3-oxo-1H-isoindol-2-yl)pentanediamide. InChIKey: DWTCYUIQXNXGEJ-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O5 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | 2-(7-nitro-3-oxo-1H-isoindol-2-yl)pentanediamide |
| InChIKey | DWTCYUIQXNXGEJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2[N+](=O)[O-])C(=O)N1C(CCC(=O)N)C(=O)N |
Computed by PubChem (NCBI)